L-lysine dication

Molecular Formula: C6H16N2O2+2


InChI: InChI=1/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/p+2/t5-/m0/s1/fC6H16N2O2/h7-9H/q+2

InChIKey: InChIKey=KDXKERNSBIXSRK-HTAGRTQHDC
SMILES: [NH3+]CCCC[[email protected]]([NH3+])C(O)=O

Names:
    CHEBI:32552
    L-lysinediium
    L-lysine dication
    L-lysinium(2+)
    (1S)-1-carboxypentane-1,5-diaminium
    [(1S)-5-azaniumyl-1-carboxy-pentyl]azanium

Registries:
    PubChem CID 5460925
    ChEBI 32552
    PubChem ID 8147662