PGEM

Molecular Formula: C20H32O5


InChI: InChI=1/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,16-17,19,23H,2-3,5-6,8-14H2,1H3,(H,24,25)/b7-4-/t16-,17-,19-/m1/s1/f/h24H

InChIKey: InChIKey=CUJMXIQZWPZMNQ-RZVJWOFSDT
SMILES: CCCCCC(=O)CC[[email protected]]1[[email protected]](O)CC(=O)[[email protected]@H]1C\C=C/CCCC(O)=O

Names:
    C04671
    KH(2)PGE(2)
    PGEM
    (Z)-7-[(1R,2R,3R)-3-hydroxy-5-oxo-2-(3-oxooctyl)cyclopentyl]hept-5-enoic acid
    (5Z)-(15S)-11alpha-Hydroxy-9,15-dioxoprostanoate
    (5Z)-(15S)-11α-hydroxy-9,15-dioxoprostanoate
    13,14-Dihydro-15-ketoprostaglandin E2
    13,14-dihydro-15-keto-PGE2
    13,14-Dihydro-15-keto-PGE2
    13,14-dihydro-15-oxo-prostaglandin E2
    15-Keto-13,14-dihydroprostaglandin E2
    15-Keto-13,14-dihydro-PGE2

Registries:
    PubChem CID 5280711
    ChEBI 15550
    Kegg C04671
    LIPID MAPS LMFA03010031
    PubChem ID 7252