(alphaS)-4-(Acetyloxy)-alpha-ethenylbenzenemethanol

Molecular Formula: C13H14O4


InChI: InChI=1/C13H14O4/c1-4-13(17-10(3)15)11-5-7-12(8-6-11)16-9(2)14/h4-8,13H,1H2,2-3H3/t13-/m0/s1

InChIKey: InChIKey=JAMQIUWGGBSIKZ-ZDUSSCGKBP
SMILES: CC(=O)O[[email protected]@H](C=C)C1=CC=C(OC(C)=O)C=C1

Names:
    C10426
    (alphaS)-4-(Acetyloxy)-alpha-ethenylbenzenemethanol
    1'-Acetoxychavicol acetate
    1'-Acetoxychavicol acetate
    1'-acetoxychavicol acetate
    52946-22-2
    [4-[(1S)-1-acetyloxyprop-2-enyl]phenyl] acetate

Registries:
    PubChem CID 119104
    ChEBI 469
    Kegg C10426
    PubChem ID 12611