
Molecular Formula: C13H18O2

InChI: InChI=1/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)/t10-/m0/s1/f/h14H

SMILES: CC(C)Cc1ccc(cc1)[[email protected]](C)C(O)=O

    (2S)-2-[4-(2-methylpropyl)phenyl]propanoic acid

    PubChem CID 39912
    ChEBI 35706
    PubChem ID 11111293