(3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-one

Molecular Formula: C5H8O5


InChI: InChI=1/C5H8O5/c6-1-2-3(7)4(8)5(9)10-2/h2-4,6-8H,1H2/t2-,3+,4-/m0/s1

InChIKey: InChIKey=CUOKHACJLGPRHD-NUNKFHFFBN
SMILES: OC[[email protected]@H]1OC(=O)[[email protected]@H](O)[[email protected]@H]1O

Names:
    CHEBI:18118
    L-Xylono-1,4-lactone
    L-xylono-1,4-lactone
    L-Xylono-1,4-lactone
    L-xylono-1,4-lactone
    (3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)dihydrofuran-2(3H)-one
    (3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-one

Registries:
    PubChem CID 439873
    ChEBI 18118
    Kegg C02994
    PubChem ID 11533181
    PubChem ID 5903