mycinose

Molecular Formula: C8H16O5


InChI: InChI=1/C8H16O5/c1-5(10)7(11)8(13-3)6(4-9)12-2/h4-8,10-11H,1-3H3/t5-,6+,7-,8+/m1/s1

InChIKey: InChIKey=QGQQTJFIYNGSEU-CWKFCGSDBG
SMILES: [H][[email protected]](C)(O)[[email protected]@]([H])(O)[[email protected]@]([H])(OC)[[email protected]@]([H])(OC)C=O

Names:
    CHEBI:29568
    D-Mycinose
    mycinose
    (2R,3R,4R,5R)-4,5-dihydroxy-2,3-dimethoxy-hexanal
    6-deoxy-2,3-di-O-methyl-D-allose
    6-Deoxy-2,3-di-O-methyl-D-allo-hexose

Registries:
    PubChem CID 5460589
    ChEBI 29568
    Kegg C11913
    PubChem ID 14075
    PubChem ID 8146558