6beta-hydroxy-17beta-estradiol

Molecular Formula: C18H24O3


InChI: InChI=1/C18H24O3/c1-18-7-6-12-11-3-2-10(19)8-14(11)16(20)9-13(12)15(18)4-5-17(18)21/h2-3,8,12-13,15-17,19-21H,4-7,9H2,1H3/t12-,13-,15+,16-,17+,18+/m1/s1

InChIKey: InChIKey=QZZRQURPSRWTLG-UXCAXZQLBO
SMILES: [H][[email protected]]12CC[[email protected]]3(C)[[email protected]@H](O)CC[[email protected]@]3([H])[[email protected]]1([H])C[[email protected]@H](O)c4cc(O)ccc24

Names:
    (6R,8S,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,6,17-triol
    6beta-Hydroxyestradiol-17beta
    6beta-hydroxyestradiol-17beta
    6beta-Hydroxyestradiol-17beta
    6beta-hydroxy-17beta-estradiol
    6β-hydroxyestradiol-17β

Registries:
    PubChem CID 440168
    ChEBI 16784
    Kegg C03935
    PubChem ID 10298551
    PubChem ID 6661