[email protected][mSUTuRBAD

Molecular Formula: C12H13NO2


InChI: InChI=1/C12H13NO2/c14-12-9-3-5-13(6-4-9)11(12)8-10-2-1-7-15-10/h1-2,7-9H,3-6H2/b11-8+

InChIKey: InChIKey=HNLJEHXLQINNQQ-DHZHZOJOBR
SMILES: C1CN2CCC1C(=O)C2=CC3=CC=CO3

Names:
    [email protected][mSUTuRBAD
    (2E)-2-(2-furylmethylidene)-1-azabicyclo[2.2.2]octan-3-one

Registries:
    PubChem CID 700274
    PubChem ID 3265450