D-cymarose

Molecular Formula: C7H14O4


InChI: InChI=1/C7H14O4/c1-5(9)7(10)6(11-2)3-4-8/h4-7,9-10H,3H2,1-2H3/t5-,6+,7-/m1/s1

InChIKey: InChIKey=GOYBREOSJSERKM-DSYKOEDSBS
SMILES: [H]C([H])(C=O)[[email protected]]([H])(OC)[[email protected]]([H])(O)[[email protected]@]([H])(C)O

Names:
    beta-Cymaropyranose
    CHEBI:10366
    Cymarose
    D-Cymarose
    D-cymarose
    (3S,4R,5R)-4,5-dihydroxy-3-methoxy-hexanal
    2,6-dideoxy-3-O-methyl-D-ribo-hexose
    2,6-Dideoxy-3-O-methyl-D-ribo-hexose
    579-04-4

Registries:
    PubChem CID 5461156
    ChEBI 10366
    Kegg C08234
    PubChem ID 10433
    PubChem ID 8148193