5(S)-Hydroperoxy-6-trans-8,11,14-cis-eicosatetraenoic acid

Molecular Formula: C20H32O4


InChI: InChI=1/C20H32O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19(24-23)17-15-18-20(21)22/h6-7,9-10,12-14,16,19,23H,2-5,8,11,15,17-18H2,1H3,(H,21,22)/b7-6-,10-9-,13-12-,16-14+/t19-/m1/s1/f/h21H

InChIKey: InChIKey=JNUUNUQHXIOFDA-KSIXYCBADT
SMILES: CCCCC\C=C/C\C=C/C\C=C/C=C/[[email protected]](CCCC(O)=O)OO

Names:
    (5S,6E,8Z,11Z,14Z)-5-hydroperoxyicosa-6,8,11,14-tetraenoic acid
    (6E,8Z,11Z,14Z)-(5S)-5-Hydroperoxyeicosa-6,8,11,14-tetraenoate
    (6E,8Z,11Z,14Z)-(5S)-5-Hydroperoxyeicosa-6,8,11,14-tetraenoic acid
    (6E,8Z,11Z,14Z)-(5S)-5-hydroperoxyicosa-6,8,11,14-tetraenoate
    5S-HpETE
    5(S)-HPETE
    5(S)-Hydroperoxy-6-trans-8,11,14-cis-eicosatetraenoic acid
    5-Hydroperoxy-6-trans-8,11,14-cis-eicosatetraenoate

Registries:
    PubChem CID 5280778
    ChEBI 15632
    Kegg C05356
    LIPID MAPS LMFA03060012
    PubChem ID 15988963
    PubChem ID 7733