D-glutaminium

Molecular Formula: C5H11N2O3+


InChI: InChI=1/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/p+1/t3-/m1/s1/fC5H11N2O3/h6,9H,7H2/q+1

InChIKey: InChIKey=ZDXPYRJPNDTMRX-LDFRXNAEDW
SMILES: NC(=O)CC[[email protected]@H]([NH3+])C(O)=O

Names:
    CHEBI:32673
    D-glutamine cation
    D-glutaminium
    (1R)-4-amino-1-carboxy-4-oxobutan-1-aminium
    [(1R)-3-carbamoyl-1-carboxy-propyl]azanium

Registries:
    PubChem CID 5460865
    ChEBI 32673
    PubChem ID 8147563