[email protected]{TpAEDBAH

Molecular Formula: C9H9N3O3


InChI: InChI=1/C9H9N3O3/c10-9(13)12-11-4-6-1-2-7-8(3-6)15-5-14-7/h1-4H,5H2,(H3,10,12,13)/b11-4+/f/h12H,10H2

InChIKey: InChIKey=UXJOKOHHCILTGL-ZRTALSSKDV
SMILES: C1OC2=C(O1)C=C(C=C2)C=NNC(=O)N

Names:
    [email protected]{TpAEDBAH
    (benzo[1,3]dioxol-5-ylmethylideneamino)urea

Registries:
    PubChem CID 5705539
    PubChem ID 3260895