D-Pyroglutamic acid

Molecular Formula: C5H7NO3


InChI: InChI=1/C5H7NO3/c7-4-2-1-3(6-4)5(8)9/h3H,1-2H2,(H,6,7)(H,8,9)/t3-/m1/s1/f/h6,8H

InChIKey: InChIKey=ODHCTXKNWHHXJC-VYZHHXEODO
SMILES: [H][[email protected]@]1(CCC(=O)N1)C(O)=O

CAS number 4042-36-8

Names:
    D-Pyroglutamic acid
    D-5-Pyrrolidone-2-carboxylic acid
    (2R)-5-oxopyrrolidine-2-carboxylic acid
    5-Oxo-D-proline
    5-oxo-D-proline
    5-Oxo-D-proline
    5-oxo-D-proline

Registries:
    PubChem CID 439685
    Beilstein =82133
    CAS 4042-36-8 (from NIST)
    ChEBI 16924
    Gmelin 1473408
    Kegg C02237
    PubChem ID 10298424
    PubChem ID 5301