(2R,3S)-2,3-dihydroxy-5-oxo-hexanedioic acid

Molecular Formula: C6H8O7


InChI: InChI=1/C6H8O7/c7-2(4(9)6(12)13)1-3(8)5(10)11/h2,4,7,9H,1H2,(H,10,11)(H,12,13)/t2-,4+/m0/s1/f/h10,12H

InChIKey: InChIKey=QUURPCHWPQNNGL-GVUYMLTKDI
SMILES: [H][[email protected]](O)(CC(=O)C(O)=O)[[email protected]@]([H])(O)C(O)=O

Names:
    CHEBI:16369
    (2R,3S)-2,3-dihydroxy-5-oxo-hexanedioic acid
    3-deoxy-L-threo-hex-2-ulosaric acid
    5-dehydro-4-deoxy-D-glucaric acid

Registries:
    PubChem CID 439290
    ChEBI 16369
    PubChem ID 11533228