(9Z,11E)-(13S)-13-Hydroperoxyoctadeca-9,11-dienoic acid

Molecular Formula: C18H32O4


InChI: InChI=1/C18H32O4/c1-2-3-11-14-17(22-21)15-12-9-7-5-4-6-8-10-13-16-18(19)20/h7,9,12,15,17,21H,2-6,8,10-11,13-14,16H2,1H3,(H,19,20)/b9-7-,15-12+/t17-/m0/s1/f/h19H

InChIKey: InChIKey=JDSRHVWSAMTSSN-MUXHCHIXDL
SMILES: CCCCC[[email protected]](OO)\C=C\C=C/CCCCCCCC(O)=O

Names:
    (9Z,11E)-(13S)-13-Hydroperoxyoctadeca-9,11-dienoate
    (9Z,11E)-(13S)-13-hydroperoxyoctadeca-9,11-dienoate
    (9Z,11E)-(13S)-13-Hydroperoxyoctadeca-9,11-dienoate
    (9Z,11E)-(13S)-13-Hydroperoxyoctadeca-9,11-dienoic acid
    (9Z,11E,13S)-13-hydroperoxyoctadeca-9,11-dienoic acid
    13S-Hydroperoxy-9Z,11E-octadecadienoic acid
    13(S)-HPODE

Registries:
    PubChem CID 5280720
    ChEBI 15655
    Kegg C04717
    PubChem ID 16037338
    PubChem ID 7289