lactosamine

Molecular Formula: C12H23NO10


InChI: InChI=1/C12H23NO10/c13-4(1-14)7(18)11(5(17)2-15)23-12-10(21)9(20)8(19)6(3-16)22-12/h1,4-12,15-21H,2-3,13H2/t4-,5+,6+,7+,8-,9-,10+,11+,12-/m0/s1

InChIKey: InChIKey=LAVNEPYDFKGEOD-JVCRWLNRBB
SMILES: [H][[email protected]](N)(C=O)[[email protected]@]([H])(O)[[email protected]]([H])(O[[email protected]@H]1O[[email protected]](CO)[[email protected]](O)[[email protected]](O)[[email protected]]1O)[[email protected]]([H])(O)CO

Names:
    D-Glucose, 2-amino-2-deoxy-4-O-beta-D-galactopyranosyl-
    LacN
    Lactosamine
    lactosamine
    (2R,3R,4R,5R)-2-amino-3,5,6-trihydroxy-4-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-hexanal
    13000-25-4
    2-Amino-2-deoxy-4-O-beta-D-galactopyranosyl-D-glucose

Registries:
    PubChem CID 119065
    ChEBI 25001
    PubChem ID 695718