XYS

Molecular Formula: C5H10O5


InChI: InChI=1/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4-,5+/m1/s1

InChIKey: InChIKey=SRBFZHDQGSBBOR-LECHCGJUBI
SMILES: O[[email protected]@H]1CO[[email protected]](O)[[email protected]](O)[[email protected]]1O

Names:
    alpha-D-Xylose
    alpha-D-xylose
    XYS
    (2S,3R,4S,5R)-oxane-2,3,4,5-tetrol

Registries:
    PubChem CID 6027
    ChEBI 28518
    Kegg C02205
    PubChem ID 11532331
    PubChem ID 5273