caranine

Molecular Formula: C16H17NO3


InChI: InChI=1/C16H17NO3/c18-12-2-1-9-3-4-17-7-10-5-13-14(20-8-19-13)6-11(10)15(12)16(9)17/h1,5-6,12,15-16,18H,2-4,7-8H2/t12-,15-,16-/m1/s1

InChIKey: InChIKey=XKYSLILSDJBMCU-DAXOMENPBC
SMILES: [H][[email protected]]12[[email protected]](O)CC=C3CCN(CC4=CC5=C(OCO5)C=C14)[[email protected]@]23[H]

Names:
    Caranine
    caranine

Registries:
    PubChem CID 441589
    ChEBI 3383
    Kegg C08521
    PubChem ID 10298869
    PubChem ID 10714