alpha-D-galactose

Molecular Formula: C7H14O5


InChI: InChI=1/C7H14O5/c1-2-3-4(8)5(9)6(10)7(11)12-3/h3-11H,2H2,1H3/t3-,4+,5+,6-,7+/m1/s1

InChIKey: InChIKey=HIPAIKSXHJHWJX-PZRMXXKTBE
SMILES: CC[[email protected]]1O[[email protected]](O)[[email protected]](O)[[email protected]@H](O)[[email protected]]1O

Names:
    Alpha-D-Galactopyranose
    alpha-D-galactose
    alpha-D-Galactose
    alpha-D-galactose
    CHEBI:28061
    (2S,3R,4S,5R,6R)-6-ethyloxane-2,3,4,5-tetrol

Registries:
    PubChem CID 9548577
    ChEBI 28061
    Kegg C00984
    PubChem ID 14717692
    PubChem ID 4231