Hepoxilin A

Molecular Formula: C20H32O4


InChI: InChI=1/C20H32O4/c1-2-3-4-5-6-10-13-18-19(24-18)16-15-17(21)12-9-7-8-11-14-20(22)23/h6-7,9-10,15-19,21H,2-5,8,11-14H2,1H3,(H,22,23)/b9-7-,10-6-,16-15+/t17?,18-,19-/m0/s1/f/h22H

InChIKey: InChIKey=SGTUOBURCVMACZ-GWIGBSAKDI
SMILES: [H][[email protected]@]1(C\C=C/CCCCC)O[[email protected]@]1([H])\C=C\C(O)C\C=C/CCCC(O)=O

Names:
    CHEBI:36190
    Hepoxilin A
    hepoxilin A3
    Hepoxilin A3
    Hepoxilin A
    Hepoxilin A3
    hepoxilin A3
    (5Z,9E)-8-hydroxy-10-[(2S,3S)-3-[(Z)-oct-2-enyl]oxiran-2-yl]deca-5,9-dienoic acid
    (5Z,9E)-8-hydroxy-10-{(2S,3S)-3-[(2Z)-oct-2-en-1-yl]oxiran-2-yl
    (5Z,9E,14Z)-(11S,12S)-11,12-Epoxy-8-hydroxyeicosa-5,9,14-trienoic acid
    (5Z,9E,14Z)-(11S,12S)-11,12-Epoxy-8-hydroxyeicosa-5,9,14-trienoic
    (5Z,9E,14Z)-(11S,12S)-11,12-Epoxy-8-hydroxyeicosa-5,9,14-trienoic acid
    (5Z,9E,14Z)-(11S,12S)-11,12-Epoxy-8-hydroxyicosa-5,9,14-trienoic acid
    8-EH-2
    8-hydroxy-11S,12S-epoxy-5Z,14Z,9E-eicosatrienoic acid
    8-hydroxy-11,12-epoxyeicosa-5,9,14-trienoic acid
    8-Hydroxy-11,12-epoxyeicosa-5,9,14-trienoic acid

Registries:
    PubChem CID 5283211
    ChEBI 36190
    Kegg C14808
    LIPID MAPS LMFA03090005
    PubChem ID 14717761