S-lactoylglutathione


InChI: InChI=1/C13H21N3O8S/c1-6(17)13(24)25-5-8(11(21)15-4-10(19)20)16-9(18)3-2-7(14)12(22)23/h6-8,17H,2-5,14H2,1H3,(H,15,21)(H,16,18)(H,19,20)(H,22,23)/t6?,7-,8-/m0/s1

InChIKey: InChIKey=VDYDCVUWILIYQF-ALKRTJFJBY
SMILES: CC(O)C(=O)SC[[email protected]](NC(=O)CC[[email protected]](N)C(O)=O)C(=O)NCC(O)=O

CAS number 25138-66-3

Names:
    S-lactoylglutathione
    (R)-S-Lactoylglutathione
    (R)-S-lactoylglutathione

Registries:
    PubChem CID 440018
    Beilstein =1717478
    CAS 25138-66-3 (from NIST)
    ChEBI 15694
    Kegg C03451
    PubChem ID 6272