dihydrokaempferol

Molecular Formula: C15H12O6


InChI: InChI=1/C15H12O6/c16-8-3-1-7(2-4-8)15-14(20)13(19)12-10(18)5-9(17)6-11(12)21-15/h1-6,14-18,20H/t14-,15+/m0/s1

InChIKey: InChIKey=PADQINQHPQKXNL-LSDHHAIUBO
SMILES: O[[email protected]@H]1[[email protected]](Oc2cc(O)cc(O)c2C1=O)c3ccc(O)cc3

Names:
    Aromadendrin
    Dihydrokaempferol
    dihydrokaempferol
    (+)-Aromadendrin
    (+)-aromadendrin
    (+)-Aromadendrin
    (+)-Dihydrokaempferol
    (+)-dihydrokaempferol
    (2S,3R)-3,5,7-trihydroxy-2-(4-hydroxyphenyl)chroman-4-one

Registries:
    PubChem CID 122850
    ChEBI 15401
    Kegg C00974
    PubChem ID 10240264
    PubChem ID 4223