[email protected]{pPAFRJIKJJYQPyHeJeiZifjhBGD

Molecular Formula: C15H19NO5S


InChI: InChI=1/C15H19NO5S/c1-4-6-12(17)11(15(19)21-5-2)9-16-13-10(7-8-22-13)14(18)20-3/h7-9,16H,4-6H2,1-3H3/b11-9-

InChIKey: InChIKey=YMTSMDDVEOGARC-LUAWRHEFBR
SMILES: CCCC(=O)C(=CNC1=C(C=CS1)C(=O)OC)C(=O)OCC

Names:
    [email protected]{pPAFRJIKJJYQPyHeJeiZifjhBGD
    methyl 2-[[(Z)-2-ethoxycarbonyl-3-oxo-hex-1-enyl]amino]thiophene-3-carboxylate

Registries:
    PubChem CID 2808588
    PubChem ID 3266624