[email protected]

Molecular Formula: C12H13BrO


InChI: InChI=1/C12H13BrO/c1-12-8-4-2-3-5(6(4)11(12)13)9(12)10(14)7(3)8/h3-9,11H,2H2,1H3/t3u,4u,5u,6?,7u,8u,9u,11-,12u/m0/s1

InChIKey: InChIKey=DYJXAYHLFCEUAR-SJODLSLPBW
SMILES: CC12C3C4CC5C3C(=O)C1C5C4C2Br

Names:
    [email protected]

Registries:
    PubChem CID 2795013
    PubChem ID 3250493