glutamic acid D-form

Molecular Formula: C5H9NO4


InChI: InChI=1/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m1/s1/f/h7,9H

InChIKey: InChIKey=WHUUTDBJXJRKMK-VCKMXKKJDF
SMILES: N[[email protected]](CCC(O)=O)C(O)=O

CAS number 6893-26-1

Names:
    D-Glutamate
    D-Glutamic acid
    D-GLUTAMIC ACID
    D-glutamic acid
    D-Glutaminic acid
    D-Glutaminsäure
    D-2-Aminoglutaric acid
    D-2-Aminopentanedioic acid
    glutamic acid D-form
    L-(+)-glutamic acid
    (R)-2-aminopentanedioic acid
    (2R)-2-aminopentanedioic acid

Registries:
    PubChem CID 23327
    Beilstein =1723800
    CAS 6893-26-1 (from NIST)
    ChEBI 15966
    chemPDB DGL
    Gmelin 201189
    Kegg C00217
    PubChem ID 10532802
    PubChem ID 3517