2-D-threo-hydroxy-3-carboxy-isocaproate

Molecular Formula: C7H10O5-2


InChI: InChI=1/C7H12O5/c1-3(2)4(6(9)10)5(8)7(11)12/h3-5,8H,1-2H3,(H,9,10)(H,11,12)/p-2/t4-,5+/m0/s1/fC7H10O5/q-2

InChIKey: InChIKey=RNQHMTFBUSSBJQ-SZZLHTBIDK
SMILES: CC(C)[[email protected]@H]([[email protected]@H](O)C([O-])=O)C([O-])=O

Names:
    CHEBI:35121
    (2R,3S)-2-hydroxy-3-isopropylsuccinate
    (2R,3S)-2-hydroxy-3-propan-2-yl-butanedioate
    (2R,3S)-2-hydroxy-3-(propan-2-yl)butanedioate
    (2R,3S)-3-isopropylmalate(2-)
    (2R,3S)-3-Isopropylmalate
    (2R,3S)-3-isopropylmalate(2-)
    2-D-threo-hydroxy-3-carboxy-isocaproate
    2-D-threo-Hydroxy-3-carboxy-isocaproate
    3-Carboxy-2-hydroxy-4-methylpentanoate
    3-Isopropylmalate

Registries:
    PubChem CID 6857402
    ChEBI 35121
    Kegg C04411
    PubChem ID 11533245
    PubChem ID 7045