(+)-Neomenthyl O-beta-D-glucoside

Molecular Formula: C16H30O6


InChI: InChI=1/C16H30O6/c1-8(2)10-5-4-9(3)6-11(10)21-16-15(20)14(19)13(18)12(7-17)22-16/h8-20H,4-7H2,1-3H3/t9-,10+,11+,12-,13-,14+,15-,16-/m1/s1

InChIKey: InChIKey=GZSDZJZIZBGBON-YRDUFCKGBI
SMILES: CC(C)[[email protected]@H]1CC[[email protected]@H](C)C[[email protected]@H]1O[[email protected]@H]2O[[email protected]](CO)[[email protected]@H](O)[[email protected]](O)[[email protected]]2O

Names:
    CHEBI:27934
    (+)-neomenthyl beta-D-glucoside
    (+)-Neomenthyl O-beta-D-glucoside
    (1S,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexyl beta-D-glucopyranoside
    (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(1S,2S,5R)-5-methyl-2-propan-2-yl-cyclohexyl]oxy-oxane-3,4,5-triol

Registries:
    PubChem CID 440243
    ChEBI 27934
    Kegg C04165
    PubChem ID 14717691
    PubChem ID 6847