L-fuculose

Molecular Formula: C6H12O5


InChI: InChI=1/C6H12O5/c1-3(8)5(10)6(11)4(9)2-7/h3,5-8,10-11H,2H2,1H3/t3-,5+,6-/m0/s1

InChIKey: InChIKey=QZNPNKJXABGCRC-LFRDXLMFBF
SMILES: [H][[email protected]@](C)(O)[[email protected]@]([H])(O)[[email protected]@]([H])(O)C(=O)CO

Names:
    CHEBI:17617
    L-fuculose
    L-Fuculose
    L-fuculose
    L-Fuculose
    L-fuculose
    (3R,4R,5S)-1,3,4,5-tetrahydroxyhexan-2-one
    6-deoxy-L-lyxo-hex-2-ulose
    6-deoxy-L-tagatose

Registries:
    PubChem CID 6857362
    ChEBI 17617
    Kegg C01721
    PubChem ID 11533113
    PubChem ID 4858