L-Lactic acid


InChI: InChI=1/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/p-1/t2-/m0/s1

InChIKey: InChIKey=JVTAAEKCZFNVCJ-KSAHRRQYBL
SMILES: C[[email protected]](O)C([O-])=O

Names:
    L-Lactate
    L-lactate
    L-Lactic acid
    (S)-Lactate
    (S)-lactate

Registries:
    PubChem CID 107689
    Beilstein =4655977
    ChEBI 16651
    Gmelin 324523
    Kegg C00186
    PubChem ID 3486
    UM-BBD c0152