D-xylulose

Molecular Formula: C5H10O5


InChI: InChI=1/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h3,5-8,10H,1-2H2/t3-,5+/m1/s1

InChIKey: InChIKey=ZAQJHHRNXZUBTE-WUJLRWPWBS
SMILES: [H][[email protected]@](O)(CO)[[email protected]]([H])(O)C(=O)CO

Names:
    D-Lyxulose
    D-threo-Pentulose
    D-Xul
    D-Xylulose
    D-xylulose
    D-Xylulose
    D-xylulose
    (3S,4R)-1,3,4,5-tetrahydroxypentan-2-one

Registries:
    PubChem CID 5289590
    ChEBI 17140
    Kegg C00310
    PubChem ID 11041586
    PubChem ID 3604