purpurosamine C

Molecular Formula: C6H14N2O2


InChI: InChI=1/C6H14N2O2/c7-3-6(10)2-1-5(8)4-9/h4-6,10H,1-3,7-8H2/t5-,6+/m1/s1

InChIKey: InChIKey=XKZCTFCTOCLUJR-RITPCOANBI
SMILES: [H]C([H])(C([H])([H])[[email protected]]([H])(O)CN)[[email protected]@]([H])(N)C=O

Names:
    CHEBI:32573
    purpurosamine C
    (2R,5S)-2,6-diamino-5-hydroxy-hexanal
    2,6-diamino-2,3,4,6-tetradeoxy-D-erythro-hexose

Registries:
    PubChem CID 5460918
    ChEBI 32573
    PubChem ID 8147642