Trioxilin A3

Molecular Formula: C20H34O5


InChI: InChI=1/C20H34O5/c1-2-3-4-5-6-10-13-18(22)19(23)16-15-17(21)12-9-7-8-11-14-20(24)25/h6-7,9-10,15-19,21-23H,2-5,8,11-14H2,1H3,(H,24,25)/b9-7-,10-6-,16-15+/t17?,18-,19+/m0/s1/f/h24H

InChIKey: InChIKey=WPLPEZUSILBTGP-DKHUZBTRDW
SMILES: CCCCC\C=C/C[[email protected]](O)[[email protected]](O)\C=C\C(O)C\C=C/CCCC(O)=O

Names:
    CHEBI:36203
    Trioxilin A3
    trioxilin A3
    (5Z,9E,11R,12S,14Z)-8,11,12-trihydroxyicosa-5,9,14-trienoic acid
    (5Z,9E,14Z)-(11R,12S)-8,11,12-Trihydroxyeicosa-5,9,14-trienoic acid
    (5Z,9E,14Z)-(11R,12S)-8,11,12-Trihydroxyicosa-5,9,14-trienoic acid
    68860-46-8
    8,11,12-Teta

Registries:
    PubChem CID 5283208
    ChEBI 36203
    Kegg C14809
    PubChem ID 14717760