D-limonene

Molecular Formula: C10H16


InChI: InChI=1/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3/t10-/m0/s1

InChIKey: InChIKey=XMGQYMWWDOXHJM-JTQLQIEIBU
SMILES: [H][[email protected]]1(CCC(C)=CC1)C(C)=C

CAS number 5989-27-5

Names:
    D-Limonen
    d-limonene
    D-limonene
    D-(+)-limonene
    (R)-limonene
    (R)-p-mentha-1,8-diene
    (R)-(+)-p-mentha-1,8-diene
    (R)-1-methyl-4-(1-methylethenyl)cyclohexene
    (R)-4-isopropenyl-1-methyl-1-cyclohexene
    (+)-Limonene
    (+)-(R)-Limonene
    (+)-(R)-limonene
    (+)-(R)-Limonene
    (+)-(4R)-Limonene
    (+)-(4R)-limonene
    (+)-(4R)-Limonene
    (+)-4-isopropenyl-1-methylcyclohexene
    (4R)-limonene
    (4R)-1-methyl-4-isopropenylcyclohex-1-ene
    (4R)-1-methyl-4-prop-1-en-2-yl-cyclohexene
    (4R)-4-isopropenyl-1-methylcyclohexene
    4βH-p-mentha-1,8-diene

Registries:
    PubChem CID 440917
    Beilstein =2204754
    CAS 5989-27-5 (from NIST)
    ChEBI 15382
    Gmelin 363573
    Kegg C06099
    PubChem ID 10298680
    PubChem ID 8364
    UM-BBD c0685