N-Formimino-L-aspartate


InChI: InChI=1/C5H8N2O4/c6-2-7-3(5(10)11)1-4(8)9/h2-3H,1H2,(H2,6,7)(H,8,9)(H,10,11)/p-2/t3-/m0/s1

InChIKey: InChIKey=XTPIFIMCFHNJOH-KXQWJZJBBO
SMILES: [O-]C(=O)C[[email protected]](NC=N)C([O-])=O

Names:
    N-Formimidoyl-L-aspartate
    N-formimidoyl-L-aspartate
    N-Formimidoyl-L-aspartate
    N-formimidoyl-L-aspartate(2-)
    N-Formimino-L-aspartate

Registries:
    PubChem CID 440000
    ChEBI 18387
    Kegg C03409
    PubChem ID 6238