Milk sugar

[The major sugar in human and bovine milk. conversion of lactose to lactic acid by Lactobacilli etc. Is important in the production of yoghurt and cheese. a sugar comprising one glucose molecule linked to a galactose molecule; occurs only in milk; cow's milk contains about 4.7% lactose.A disaccharide sugar which is commonly found in milk. It consists of galactose and glucose, where an enzyme called lactase can break lactose into these two smaller components. microorganisms convert lactose to pyruvic acid, which results in the souring of the milk for example.

Molecular Formula: C₁₂H₂₂O₁₁

InChI: InChI=1/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5+,6+,7-,8-,9-,10-,11+,12+/m1/s1

InChIKey: InChIKey=GUBGYTABKSRVRQ-XLOQQCSPBD
SMILES: OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O

Names:
    alpha-Lactose
    alpha-lactose
    Anhydrous lactose
    Lactose
    LACTOSE
    Milk sugar
    β-D-Galp-(1→4)-α-D-Glcp
    (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-oxane-3,4,5-triol
    1-beta-D-Galactopyranosyl-4-alpha-D-glucopyranose
    4-O-β-D-galactopyranosyl-α-D-glucopyranose

Registries:
    PubChem CID 84571
    Beilstein =5758726
    Beilstein =90842
    ChEBI 36219
    chemPDB LBT
    Kegg C00243
    PubChem ID 10220749
    PubChem ID 3542