2,3-dinor-8-epi-prostaglandin F2alpha

Molecular Formula: C18H30O5


InChI: InChI=1/C18H30O5/c1-2-3-4-7-13(19)10-11-15-14(16(20)12-17(15)21)8-5-6-9-18(22)23/h5-6,10-11,13-17,19-21H,2-4,7-9,12H2,1H3,(H,22,23)/b6-5-,11-10+/t13-,14-,15+,16-,17+/m0/s1/f/h22H

InChIKey: InChIKey=IDKLJIUIJUVJNR-DZERQQBDDD
SMILES: CCCCC[[email protected]](O)\C=C\[[email protected]]1[[email protected]](O)C[[email protected]](O)[[email protected]]1C\C=C/CC(O)=O

Names:
    CHEBI:34230
    (Z)-5-[(1S,2S,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]pent-3-enoic acid
    (3Z)-5-{(1S,2R,3R,5S)-3,5-dihydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]cyclopentyl
    (5Z,13E,15S)-9alpha,11alpha,15-trihydroxy-2,3-dinor-8beta-prosta-5,13-dien-1-oic acid
    2,3-dinor-8-epi-prostaglandin F2alpha
    2,3-Dinor-8-iso PGF2alpha
    2,3-Dinor-8-iso prostaglandin F2alpha
    221664-05-7

Registries:
    PubChem CID 9548881
    ChEBI 34230
    Kegg C14794
    PubChem ID 14718398