levoglucosenone

Molecular Formula: C6H6O3


InChI: InChI=1/C6H6O3/c7-5-2-1-4-3-8-6(5)9-4/h1-2,4,6H,3H2/t4-,6+/m0/s1

InChIKey: InChIKey=HITOXZPZGPXYHY-UJURSFKZBB
SMILES: [H][[email protected]]12CO[[email protected]]([H])(O1)C(=O)C=C2

Names:
    levoglucosenone
    (1R,5R)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one

Registries:
    PubChem CID 699486
    ChEBI 30999
    PubChem ID 15363513