D-Galactonic acid


InChI: InChI=1/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/p-1/t2-,3+,4+,5-/m1/s1

InChIKey: InChIKey=RGHNJXZEOKUKBD-PULXDEHUBX
SMILES: [H][[email protected]@](O)(CO)[[email protected]]([H])(O)[[email protected]]([H])(O)[[email protected]@]([H])(O)C([O-])=O

Names:
    D-Galactonate
    D-galactonate
    D-Galactonic acid

Registries:
    PubChem CID 604
    ChEBI 12931
    Kegg C00880
    PubChem ID 4136