vicianose

Molecular Formula: C11H20O10


InChI: InChI=1/C11H20O10/c12-3-1-19-11(9(17)5(3)13)20-2-4-6(14)7(15)8(16)10(18)21-4/h3-18H,1-2H2/t3-,4+,5-,6+,7-,8+,9+,10?,11-/m0/s1

InChIKey: InChIKey=QYNRIDLOTGRNML-ULAALWPKBZ
SMILES: O[[email protected]]1CO[[email protected]@H](OC[[email protected]]2OC(O)[[email protected]](O)[[email protected]@H](O)[[email protected]@H]2O)[[email protected]](O)[[email protected]]1O

Names:
    O-alpha-L-Arabinopyranosyl-(1-6)-beta-D-glucopyranose
    Vicianose
    vicianose
    Vicianose
    vicianose
    (3R,4S,5S,6R)-6-[[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol
    6-O-α-L-arabinopyranosyl-D-glucopyranose

Registries:
    PubChem CID 439537
    ChEBI 16177
    Kegg C01625
    PubChem ID 10298367
    PubChem ID 4776