d-isomenthone

Molecular Formula: C10H18O


InChI: InChI=1/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-9H,4-6H2,1-3H3/t8-,9-/m1/s1

InChIKey: InChIKey=NFLGAXVYCFJBMK-RKDXNWHRBG
SMILES: CC(C)[[email protected]]1CC[[email protected]@H](C)CC1=O

CAS number 1196-31-2

Names:
    d-isomenthone
    ZINC03860577
    (+)-Isomenthone
    (+)-isomenthone
    (1R,4R)-p-menthan-3-one
    (2R,5R)-2-isopropyl-5-methylcyclohexanone
    (2R,5R)-5-methyl-2-propan-2-yl-cyclohexan-1-one
    (2R-cis)-5-methyl-2-(1-methylethyl)cyclohexanone
    10458-14-7

Registries:
    PubChem CID 70962
    Beilstein =2041366
    Beilstein =5245019
    CAS 1196-31-2 (from NIST)
    ChEBI 36492
    Kegg C11952
    PubChem ID 12157105
    PubChem ID 14113