(R)-duloxetine

Molecular Formula: C18H19NOS


InChI: InChI=1/C18H19NOS/c1-19-12-11-17(18-10-5-13-21-18)20-16-9-4-7-14-6-2-3-8-15(14)16/h2-10,13,17,19H,11-12H2,1H3/t17-/m1/s1

InChIKey: InChIKey=ZEUITGRIYCTCEM-QGZVFWFLBL
SMILES: CNCC[[email protected]@H](Oc1cccc2ccccc12)c3cccs3

Names:
    (R)-duloxetine
    (3R)-N-methyl-3-naphthalen-1-yloxy-3-thiophen-2-yl-propan-1-amine

Registries:
    PubChem CID 10334821
    ChEBI 36797
    PubChem ID 15345608