dopamine

Dopamine - definition from Biology-Online.org

[(Science: drug) a catecholamine neurotransmitter and hormone (153 D), formed by decarboxylation of dehydroxyphenylalanine (dopa). a precursor of adrenaline and noradrenaline. pharmacologic action: 1. precursor of norepinephrine 2. stimulates dopaminergic, alpha and beta-1 adrenergic receptors: 3. dopaminergic (1-2 mcg/kg per min): cerebral, renal, and mesenteric vasodilation increase urine output 4. mixed alpha and beta-1 (2-10 mcg/kg per min): increases cardiac ouput with moderate increase systemic vascular resistance 5. Predominantly alpha (>20 mcg/kg per min): increases systemic vascular resistance Uses: 1. treat hypotension associated with bradycardia 2. stimulate cardiac output and urine output Dose: 1. start infusion at 1-5 mcg/kg per min and titrate to effect. 2. use the lowest dose that provides the desired hemodynamic improvement. 3. Do not exceed 20 mcg/kg per min. potential complications: 1. May increase pulmonary pressure and worsen pu

MediLexicon dopamine - Medical Dictionary Definition for Term 'dopamine'

[1. An intermediate in tyrosine metabolism and precursor of norepinephrine and epinephrine; neurotransmitter is the peripheral and central nervous systems; depletion of dopamine produces Parkinson disease.

Molecular Formula: C8H11NO2


InChI: InChI=1/C8H11NO2/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5,10-11H,3-4,9H2

InChIKey: InChIKey=VYFYYTLLBUKUHU-UHFFFAOYAA
SMILES: NCCc1ccc(O)c(O)c1

CAS number 51-61-6

Names:
    Dopamine
    dopamine
    Dopamine
    dopamine
    KBio3_002962
    2-(3,4-Dihydroxyphenyl)ethylamine
    2-(3,4-dihydroxyphenyl)ethylamine
    2-(3,4-Dihydroxyphenyl)ethylamine
    3,4-Dihydroxyphenethylamine
    3,4-dihydroxyphenethylamine
    3,4-Dihydroxyphenethylamine
    3-hydroxytyramine
    4-(2-aminoethyl)benzene-1,2-diol
    4-(2-Aminoethyl)benzene-1,2-diol
    4-(2-aminoethyl)benzene-1,2-diol
    4-(2-Aminoethyl)benzene-1,2-diol
    4-(2-aminoethyl)catechol
    4-(2-aminoethyl)pyrocatechol
    4-(2-Aminoethyl)-1,2-benzenediol
    4-(2-aminoethyl)-1,2-benzenediol
    4-(2-Aminoethyl)-1,2-benzenediol

Registries:
    PubChem CID 681
    CAS 51-61-6 (from NIST)
    ChEBI 18243
    Kegg C03758
    PubChem ID 11373057
    PubChem ID 6517