9-Riburonosyladenine


InChI: InChI=1/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6,9-10,16-17H,1,11H2,(H,12,13)/t4-,6-,9?,10-/m1/s1

InChIKey: InChIKey=WZHRQXFILFZGEU-ARCMKTJDBK
SMILES: NC1=C2N=CN([[email protected]@H]3O[[email protected]](CO)[[email protected]@H](O)C3=O)C2N=CN1

Names:
    9-Riburonosyladenine
    9-riburonosyladenine
    9-Riburonosyladenine
    9-riburonosyladenine

Registries:
    PubChem CID 443235
    ChEBI 16009
    Kegg C11501
    PubChem ID 13671