Gentamicin C2

Molecular Formula: C20H41N5O7


InChI: InChI=1/C20H41N5O7/c1-8(21)12-5-4-9(22)18(30-12)31-15-10(23)6-11(24)16(13(15)26)32-19-14(27)17(25-3)20(2,28)7-29-19/h8-19,25-28H,4-7,21-24H2,1-3H3/t8-,9-,10+,11-,12+,13+,14-,15-,16-,17-,18-,19-,20+/m1/s1

InChIKey: InChIKey=XUFIWSHGXVLULG-JYDJLPLMBR
SMILES: [H][C@](C)(N)[C@]1([H])CC[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@@H](O[C@H]3OC[C@](C)(O)[C@H](NC)[C@H]3O)[C@H]2O)O1

CAS number 25876-11-3

Names:
    C02033
    Gentamicin C2
    gentamicin C2
    Gentamycin C2
    O-3-Deoxy-4-C-methyl-3-(methylamino)-beta-L-arabinopyranosyl-(1-6)-
    (2R,3R,4R,5S)-2-[(1R,2R,3R,4S,6R)-4,6-diamino-3-[(2R,3R,6S)-3-amino-6-[(1R)-1-aminoethyl]oxan-2-yl]oxy-2-hydroxy-cyclohexyl]oxy-5-methyl-4-methylamino-oxane-3,5-diol
    25876-11-3

Registries:
    PubChem CID 439633
    CAS 25876-11-3 (from NIST)
    ChEBI 28292
    Kegg C02033
    PubChem ID 5126