hydrogen D-tyrosinate

Molecular Formula: C9H10NO3-


InChI: InChI=1/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/p-1/t8-/m1/s1/fC9H10NO3/q-1

InChIKey: InChIKey=OUYCCCASQSFEME-MGPYZLKQDA
SMILES: N[[email protected]](Cc1ccc(O)cc1)C([O-])=O

Names:
    CHEBI:32773
    D-tyrosinate(1−)
    D-tyrosinate(1-)
    D-tyrosine monoanion
    hydrogen D-tyrosinate
    (2R)-2-amino-3-(4-hydroxyphenyl)propanoate

Registries:
    PubChem CID 5460814
    ChEBI 32773
    PubChem ID 8147463