Apioside

Molecular Formula: C26H28O14


InChI: InChI=1/C26H28O14/c27-8-18-20(32)21(33)22(40-25-23(34)26(35,9-28)10-36-25)24(39-18)37-13-5-14(30)19-15(31)7-16(38-17(19)6-13)11-1-3-12(29)4-2-11/h1-7,18,20-25,27-30,32-35H,8-10H2/t18-,20-,21+,22-,23+,24-,25+,26-/m1/s1

InChIKey: InChIKey=NTDLXWMIWOECHG-YRCFQSNFBK
SMILES: OC[C@H]1O[C@@H](Oc2cc(O)c3C(=O)C=C(Oc3c2)c4ccc(O)cc4)[C@H](O[C@@H]5OC[C@](O)(CO)[C@H]5O)[C@@H](O)[C@@H]1O

Names:
    apigenin 7-O-[β-D-apiosyl-(1→2)-β-D-glucoside]
    Apiin
    apiin
    Apioside
    DivK1c_007035
    7-O-(beta-D-Apiofuranosyl-1,2-beta-D-glucosyl)-5,7,4'-
    7-O-(beta-D-Apiofuranosyl-1,2-beta-D-glucosyl)-5,7,4'-trihydroxyflavone
    7-O-(β-D-apiofuranosyl-1,2-β-D-glucosyl)-5,7,4'-trihydroxyflavone
    7-((2-O-beta-D-Apiofuranosyl-beta-D-glucopyranosyl)oxy)-5-hydroxy-2-(4-ir._7
    7-[(2S,3R,4S,5S,6R)-3-[(2S,3S,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)chromen-4-one
    7-[(2-O-D-Apio-beta-D-furanosyl-beta-D-glucopyranosyl)oxy]-5-hydroxy-i5_7

Registries:
    PubChem CID 5280746
    ChEBI 15932
    Kegg C04858
    PubChem ID 11342210
    PubChem ID 7413