glc

Molecular Formula: C6H12O5


InChI: InChI=1/C6H12O5/c7-1-4-6(10)5(9)3(8)2-11-4/h3-10H,1-2H2/t3-,4+,5+,6+/m0/s1

InChIKey: InChIKey=MPCAJMNYNOGXPB-SLPGGIOYBT
SMILES: OC[[email protected]]1OC[[email protected]](O)[[email protected]@H](O)[[email protected]@H]1O

CAS number 154-58-5

Names:
    glc
    (2R,3S,4R,5S)-2-(hydroxymethyl)oxane-3,4,5-triol
    1,5-Anhydroglucitol
    1,5-anhydroglucitol
    1,5-Anhydroglucitol
    1,5-ANHYDROSORBITOL
    1,5-Anhydro-D-glucitol
    1,5-anhydro-D-glucitol
    1,5-Anhydro-D-glucitol
    1,5-anhydro-D-glucitol
    1,5-Anhydro-D-sorbitol
    1,5-anhydro-D-sorbitol
    1,5-Anhydro-D-sorbitol

Registries:
    PubChem CID 64960
    CAS 154-58-5 (from NIST)
    ChEBI 16070
    chemPDB ASO
    Kegg C07326
    PubChem ID 11538159
    PubChem ID 9534