D-cysteine zwitterion

Molecular Formula: C3H7NO2S


InChI: InChI=1/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m1/s1/f/h4H

InChIKey: InChIKey=XUJNEKJLAYXESH-DUOZNTKNDU
SMILES: [NH3+][[email protected]](CS)C([O-])=O

Names:
    CHEBI:35236
    D-cysteine zwitterion
    (2R)-2-azaniumyl-3-sulfanyl-propanoate
    (2S)-2-ammonio-3-mercaptopropanoate
    (2S)-2-ammonio-3-sulfanylpropanoate

Registries:
    PubChem CID 6419721
    ChEBI 35236
    PubChem ID 10318890