(2S)-2-amino-4-hydroxypentanedioate


InChI: InChI=1/C5H9NO5/c6-2(4(8)9)1-3(7)5(10)11/h2-3,7H,1,6H2,(H,8,9)(H,10,11)/p-2/t2-,3?/m0/s1

InChIKey: InChIKey=HBDWQSHEVMSFGY-QBWMXBMHBG
SMILES: N[[email protected]@H](CC(O)C([O-])=O)C([O-])=O

Names:
    (2S)-2-amino-4-hydroxypentanedioate
    4-Hydroxy-L-glutamate
    4-hydroxy-L-glutamate
    4-hydroxy-L-glutamate(2-)
    4-Hydroxy-L-glutamic acid

Registries:
    PubChem CID 439902
    ChEBI 16338
    Kegg C03079
    PubChem ID 5977