(2S)-2-phenylchromane

Molecular Formula: C15H14O


InChI: InChI=1/C15H14O/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15/h1-9,15H,10-11H2/t15-/m0/s1

InChIKey: InChIKey=QOLIPNRNLBQTAU-HNNXBMFYBA
SMILES: C1Cc2ccccc2O[[email protected]@H]1c3ccccc3

Names:
    CHEBI:36103
    (2S)-flavan
    (2S)-2-phenylchromane
    (2S)-2-phenylchroman

Registries:
    PubChem CID 1232441
    Beilstein =6921727
    Beilstein =8683796
    ChEBI 36103
    PubChem ID 14718239